CAS 1333541-65-3 appears in our catalog under these names: 4-Amino-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one hydrochloride, 97%, 4-Amino-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 0,5g, 50mg.
4-amino-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one;hydrochloride (CAS 1333541-65-3) is a chemical compound with the molecular formula C6H10ClF3N2O and a molecular weight of 218.60 g/mol. IUPAC name: 4-amino-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one;hydrochloride. InChIKey: ULIXZGAWPXUKCI-UHFFFAOYSA-N.
| Molecular formula | C6H10ClF3N2O |
|---|---|
| Molecular weight | 218.60 g/mol |
| IUPAC name | 4-amino-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one;hydrochloride |
| InChIKey | ULIXZGAWPXUKCI-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)