Products 2098114-26-0
CAS 2098114-26-0 appears in our catalog under these names: 1-(2,2,2-Trifluoroethyl)piperazin-2-one hydrochloride, 97%, 97%, 1-(2,2,2-Trifluoroethyl)piperazin-2-one hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(2,2,2-trifluoroethyl)piperazin-2-one;hydrochloride (CAS 2098114-26-0) is a chemical compound with the molecular formula C6H10ClF3N2O and a molecular weight of 218.60 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)piperazin-2-one;hydrochloride. InChIKey: WSRRTWDKDJKSSW-UHFFFAOYSA-N.
| Molecular formula | C6H10ClF3N2O |
|---|---|
| Molecular weight | 218.60 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)piperazin-2-one;hydrochloride |
| InChIKey | WSRRTWDKDJKSSW-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)