CAS 124668-52-6 appears in our catalog under these names: N-((Azetidin-3-yl)methyl)-2,2,2-trifluoroacetamide hydrochloride, 95%, N-((Azetidin-3-yl)methyl)-2,2,2-trifluoroacetamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
N-(azetidin-3-ylmethyl)-2,2,2-trifluoroacetamide;hydrochloride (CAS 124668-52-6) is a chemical compound with the molecular formula C6H10ClF3N2O and a molecular weight of 218.60 g/mol. IUPAC name: N-(azetidin-3-ylmethyl)-2,2,2-trifluoroacetamide;hydrochloride. InChIKey: VNLUDOWOYBHVIO-UHFFFAOYSA-N.
| Molecular formula | C6H10ClF3N2O |
|---|---|
| Molecular weight | 218.60 g/mol |
| IUPAC name | N-(azetidin-3-ylmethyl)-2,2,2-trifluoroacetamide;hydrochloride |
| InChIKey | VNLUDOWOYBHVIO-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CNC(=O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)