cas: 124004-75-7 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-1-(2-fluorophenyl)ethanone 97% (CAS 124004-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A439922-100mg |
| cas | 124004-75-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 348.12 Pln | |
| Ambeed | 5g | 1449.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A439922 |
2,2,2-trifluoro-1-(2-fluorophenyl)ethanone (CAS 124004-75-7) is a chemical compound with the molecular formula C8H4F4O and a molecular weight of 192.11 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-fluorophenyl)ethanone. InChIKey: NVSKOJZXIQFFBQ-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O |
|---|---|
| Molecular weight | 192.11 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-fluorophenyl)ethanone |
| InChIKey | NVSKOJZXIQFFBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)