cas: 30724-22-2 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-1-(3-methoxyphenyl)ethanone 98% (CAS 30724-22-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A929791-250mg |
| cas | 30724-22-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 787.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A929791 |
2,2,2-trifluoro-1-(3-methoxyphenyl)ethanone (CAS 30724-22-2) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-methoxyphenyl)ethanone. InChIKey: YCVFUKRFGPIHOI-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-methoxyphenyl)ethanone |
| InChIKey | YCVFUKRFGPIHOI-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)