cas: 30724-22-2 — see every product listed under this CAS number, including other names
2,2,2-trifluoro-1-(3-methoxyphenyl)ethanone, 97%, 97% (CAS 30724-22-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118JR5-250mg |
| cas | 30724-22-2 |
| size | 250mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 626.00 Pln | |
| Chemat | 25g | 2061.20 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 10g | 1029.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,2,2-trifluoro-1-(3-methoxyphenyl)ethanone (CAS 30724-22-2) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-methoxyphenyl)ethanone. InChIKey: YCVFUKRFGPIHOI-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-methoxyphenyl)ethanone |
| InChIKey | YCVFUKRFGPIHOI-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)