Products 612-78-2
CAS 612-78-2 appears in our catalog under these names: 2,2'-Binaphthyl, 2,2'-Binaphthyl 10 µg/mL in Acetonitrile, 2，2'–Binaphthalene, 2,2'-Binaphthalene 98%, 2,2'-Binaphthalene, 98%, 98%. Offered by: Dr. Ehrenstorfer, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10mg, 10ml, 100mg, 1g, 250mg, 5g.
2-naphthalen-2-ylnaphthalene (CAS 612-78-2) is a chemical compound with the molecular formula C20H14 and a molecular weight of 254.3 g/mol. IUPAC name: 2-naphthalen-2-ylnaphthalene. InChIKey: MSBVBOUOMVTWKE-UHFFFAOYSA-N.
| Molecular formula | C20H14 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 2-naphthalen-2-ylnaphthalene |
| InChIKey | MSBVBOUOMVTWKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)