Products 210487-05-1
CAS 210487-05-1 appears in our catalog under these names: 2,2'-Binaphthyl-d14, >95% (HPLC), 2,2'-Binaphthyl-d14, 99 atom % D, min 98% Chemical Purity, 2,2′-Binaphthyl-d14. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 10 mg, 2 mg, 1 mg.
1,2,3,4,5,6,8-heptadeuterio-7-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)naphthalene (CAS 210487-05-1) is a chemical compound with the molecular formula C20H14 and a molecular weight of 268.4 g/mol. IUPAC name: 1,2,3,4,5,6,8-heptadeuterio-7-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)naphthalene. InChIKey: MSBVBOUOMVTWKE-WZAAGXFHSA-N.
| Molecular formula | C20H14 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | 1,2,3,4,5,6,8-heptadeuterio-7-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)naphthalene |
| InChIKey | MSBVBOUOMVTWKE-WZAAGXFHSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])C3=C(C4=C(C(=C(C(=C4C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)