CAS 604-53-5 appears in our catalog under these names: 1,1'-Binaphthyl, 98%, 1,1'-Binaphthyl, 1,1'–Binaphthyl, 1,1'-Binaphthyl, 98% , 1,1'-Binaphthyl, 97%. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros). Available pack sizes: 5g, 1g, 10mg, 100g, 25g, 10g.
1-naphthalen-1-ylnaphthalene (CAS 604-53-5) is a chemical compound with the molecular formula C20H14 and a molecular weight of 254.3 g/mol. IUPAC name: 1-naphthalen-1-ylnaphthalene. InChIKey: ZDZHCHYQNPQSGG-UHFFFAOYSA-N.
| Molecular formula | C20H14 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 1-naphthalen-1-ylnaphthalene |
| InChIKey | ZDZHCHYQNPQSGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)