Products 486-52-2
CAS 486-52-2 appears in our catalog under these names: 6,12-Dihydroindeno(1,2-b)fluorene, 95-<97%, 6,12-Dihydroindeno(1,2-b)fluorene, ≥97-<99%, 6，12–Dihydroindeno(1，2–b)fluorene, 6,12-Dihydroindeno[1,2-b]fluorene 97%, 6,12-Dihydroindeno[1,2-b]fluorene, 98%, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g, 1g, 5g.
6,12-dihydroindeno[1,2-b]fluorene (CAS 486-52-2) is a chemical compound with the molecular formula C20H14 and a molecular weight of 254.3 g/mol. IUPAC name: 6,12-dihydroindeno[1,2-b]fluorene. InChIKey: QBBPWJMJLXOORS-UHFFFAOYSA-N.
| Molecular formula | C20H14 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 6,12-dihydroindeno[1,2-b]fluorene |
| InChIKey | QBBPWJMJLXOORS-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=CC4=C(C=C31)C5=CC=CC=C5C4 |
Computed by PubChem (NCBI)