CAS 602-55-1 appears in our catalog under these names: 9-Phenylanthracene, 9–Phenylanthracene, 9-Phenylanthracene, >98.0%(GC), 9-PHENYLANTHRACENE, 98%, 9-Phenylanthracene, 98%, 98%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 1g, 2,5g, 500mg, 25mg, 100g, 25g, 5g, 10g.
9-phenylanthracene (CAS 602-55-1) is a chemical compound with the molecular formula C20H14 and a molecular weight of 254.3 g/mol. IUPAC name: 9-phenylanthracene. InChIKey: LUBXLGUQZVKOFP-UHFFFAOYSA-N.
| Molecular formula | C20H14 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 9-phenylanthracene |
| InChIKey | LUBXLGUQZVKOFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=CC4=CC=CC=C42 |
Computed by PubChem (NCBI)