cas: 25981-82-2 — see every product listed under this CAS number, including other names
2,3,3,5-Tetramethyl-3H-indole 96% (CAS 25981-82-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A771312-10g |
| cas | 25981-82-2 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 248.00 Pln | |
| Ambeed | 25g | 487.19 Pln | |
| Ambeed | 100g | 1026.75 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A771312 |
2,3,3,5-tetramethylindole (CAS 25981-82-2) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 2,3,3,5-tetramethylindole. InChIKey: RQVAPBRSUHSDGP-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 2,3,3,5-tetramethylindole |
| InChIKey | RQVAPBRSUHSDGP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C2(C)C)C |
Computed by PubChem (NCBI)