cas: 771-60-8 — see every product listed under this CAS number, including other names
2,3,4,5,6-Pentafluoroaniline, 97%, 97% (CAS 771-60-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FCY-1g |
| cas | 771-60-8 |
| size | 1g |
| availability | 700g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 266.00 Pln | |
| Chemat | 100g | 798.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3,4,5,6-pentafluoroaniline (CAS 771-60-8) is a chemical compound with the molecular formula C6H2F5N and a molecular weight of 183.08 g/mol. IUPAC name: 2,3,4,5,6-pentafluoroaniline. InChIKey: NOXLGCOSAFGMDV-UHFFFAOYSA-N.
| Molecular formula | C6H2F5N |
|---|---|
| Molecular weight | 183.08 g/mol |
| IUPAC name | 2,3,4,5,6-pentafluoroaniline |
| InChIKey | NOXLGCOSAFGMDV-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)N |
Computed by PubChem (NCBI)