cas: 771-60-8 — see every product listed under this CAS number, including other names
2,3,4,5,6-Pentafluoroaniline, 97% (CAS 771-60-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 50g, 25g, 100g, 1kg. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 147080050 |
| cas | 771-60-8 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 166.15 Pln | |
| Thermo Scientific (Acros) | 10g | 257.02 Pln | |
| Thermo Scientific (Acros) | 50g | 868.62 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 341.56 Pln | |
| Fluorochem | 100g | 1185.02 Pln | |
| Fluorochem | 1kg | 8588.66 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2,3,4,5,6-pentafluoroaniline (CAS 771-60-8) is a chemical compound with the molecular formula C6H2F5N and a molecular weight of 183.08 g/mol. IUPAC name: 2,3,4,5,6-pentafluoroaniline. InChIKey: NOXLGCOSAFGMDV-UHFFFAOYSA-N.
| Molecular formula | C6H2F5N |
|---|---|
| Molecular weight | 183.08 g/mol |
| IUPAC name | 2,3,4,5,6-pentafluoroaniline |
| InChIKey | NOXLGCOSAFGMDV-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)N |
Computed by PubChem (NCBI)