cas: 38233-47-5 — see every product listed under this CAS number, including other names
2,3,4-trifluoro-5-methoxybenzoic acid, 98%, 98% (CAS 38233-47-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C87N-100mg |
| cas | 38233-47-5 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 1398.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3,4-trifluoro-5-methoxybenzoic acid (CAS 38233-47-5) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2,3,4-trifluoro-5-methoxybenzoic acid. InChIKey: CGMSFYATZQKRJY-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2,3,4-trifluoro-5-methoxybenzoic acid |
| InChIKey | CGMSFYATZQKRJY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C(=O)O)F)F)F |
Computed by PubChem (NCBI)