CAS 112811-65-1 appears in our catalog under these names: 3-Methoxy-2,4,5-trifluorobenzoic acid, 98%, Moxifloxacin Impurity 36, 2,4,5–Trifluoro–3–methoxybenzoic Acid, 2,4,5-Trifluoro-3-methoxybenzoic Acid, >98.0%(GC)(T), 2,4,5-Trifluoro-3-methoxybenzoic acid, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, GLPBio, TCI, Chemat. Available pack sizes: 100g, 25g, 5g, 500g, on request, 10g, 1kg, 1000g.
2,4,5-trifluoro-3-methoxybenzoic acid (CAS 112811-65-1) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2,4,5-trifluoro-3-methoxybenzoic acid. InChIKey: YVJHZWWMKFQKDC-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-methoxybenzoic acid |
| InChIKey | YVJHZWWMKFQKDC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1F)F)C(=O)O)F |
Computed by PubChem (NCBI)