Products 38233-47-5
CAS 38233-47-5 appears in our catalog under these names: 2,3,4-Trifluoro-5-methoxybenzoic Acid, 2,3,4-trifluoro-5-methoxybenzoic acid, 95%, 5-Methoxy-2,3,4-trifluorobenzoic acid 98%, 5-Methoxy-2,3,4-trifluorobenzoic acid, 98%, 2,3,4-trifluoro-5-methoxybenzoic acid, 98%, 98%. Offered by: TRC, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 25mg, 5g, 1g, 100mg, on request.
2,3,4-trifluoro-5-methoxybenzoic acid (CAS 38233-47-5) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2,3,4-trifluoro-5-methoxybenzoic acid. InChIKey: CGMSFYATZQKRJY-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2,3,4-trifluoro-5-methoxybenzoic acid |
| InChIKey | CGMSFYATZQKRJY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C(=O)O)F)F)F |
Computed by PubChem (NCBI)