Products 1214372-41-4
CAS 1214372-41-4 appears in our catalog under these names: 2-(Difluoromethoxy)-3-fluorobenzoic acid, 95%, 2-(Difluoromethoxy)-3-fluorobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
2-(difluoromethoxy)-3-fluorobenzoic acid (CAS 1214372-41-4) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2-(difluoromethoxy)-3-fluorobenzoic acid. InChIKey: PDYXFLQVTGGCIY-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2-(difluoromethoxy)-3-fluorobenzoic acid |
| InChIKey | PDYXFLQVTGGCIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC(F)F)C(=O)O |
Computed by PubChem (NCBI)