Products 1214387-26-4

CAS 1214387-26-4 is the registry number for Methyl 4-hydroxy-2,3,5-trifluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2,3,5-trifluoro-4-hydroxybenzoate (CAS 1214387-26-4) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: methyl 2,3,5-trifluoro-4-hydroxybenzoate. InChIKey: ABVCVRWXIBXQHL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F3O3
Molecular weight206.12 g/mol
IUPAC namemethyl 2,3,5-trifluoro-4-hydroxybenzoate
InChIKeyABVCVRWXIBXQHL-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C(=C1F)F)O)F

Computed by PubChem (NCBI)