2,3,5-Trifluorophenylboronic acid, 98%
cas: 247564-73-4 — see every product listed under this CAS number, including other names
2,3,5-Trifluorophenylboronic acid, 98% (CAS 247564-73-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F218912-1G |
| cas | 247564-73-4 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 200.99 Pln | |
| Fluorochem | 10g | 336.36 Pln | |
| Fluorochem | 25g | 633.13 Pln | |
| Fluorochem | 100g | 2262.76 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 25g | 798.69 Pln | |
| Ambeed | 100g | 2728.88 Pln | |
| Ambeed | 500g | 12068.31 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 281.04 Pln | |
| BLDpharm | 25g | 858.61 Pln | |
| BLDpharm | 100g | 2935.66 Pln | |
| BLDpharm | 500g | 11826.97 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2,3,5-trifluorophenyl)boronic acid (CAS 247564-73-4) is a chemical compound with the molecular formula C6H4BF3O2 and a molecular weight of 175.90 g/mol. IUPAC name: (2,3,5-trifluorophenyl)boronic acid. InChIKey: IRMUMGKQAXLGHK-UHFFFAOYSA-N.
| Molecular formula | C6H4BF3O2 |
|---|---|
| Molecular weight | 175.90 g/mol |
| IUPAC name | (2,3,5-trifluorophenyl)boronic acid |
| InChIKey | IRMUMGKQAXLGHK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,3,5-Trifluorophenylboronic acid, (2,3,5-trifluorophenyl)boronic Acid, 2,3,5-Trifluorobenzeneboronic Acid, 2,3,5-Trifluorophenylboronic acid, >=95%, 2,3,5-Trifluorophenylboronicacid, (2,3,5-triflu, IRMUMGKQAXLGHK-UHFFFAOYSA-N, B-(2,3,5-Trifluorophenyl)boronic acid, Boronic acid, B-?(2,?3,?5-?trifluorophenyl)?-, 2,3,5-Trifluorophenylboronic acid(contains varying amounts of Anhydride)