2,3-DIBROMONAPHTHALENE, 98%, 98%
cas: 13214-70-5 — see every product listed under this CAS number, including other names
2,3-DIBROMONAPHTHALENE, 98%, 98% (CAS 13214-70-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1121AI-100g |
| cas | 13214-70-5 |
| size | 100g |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 5219.60 Pln | |
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 333.20 Pln | |
| Chemat | 10g | 592.40 Pln | |
| Chemat | 25g | 1365.20 Pln | |
| Chemat | 250g | 8915.60 Pln | |
| Chemat | 500g | 16368.00 Pln | |
| Chemat | 1kg | 20478.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3-dibromonaphthalene (CAS 13214-70-5) is a chemical compound with the molecular formula C10H6Br2 and a molecular weight of 285.96 g/mol. IUPAC name: 2,3-dibromonaphthalene. InChIKey: GTILXPRQNNYDHT-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2 |
|---|---|
| Molecular weight | 285.96 g/mol |
| IUPAC name | 2,3-dibromonaphthalene |
| InChIKey | GTILXPRQNNYDHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)Br)Br |
Computed by PubChem (NCBI)