Products 6286-30-2
CAS 6286-30-2 appears in our catalog under these names: 2,3–Dibromo–3–phenylpropionic Acid, 2,3-Dibromo-3-phenylpropionic Acid, >98.0%(HPLC)(T), ALPHA,BETA-DIBROMOHYDROCINNAMIC ACID, 9&, 2,3-Dibromo-3-phenylpropanoic acid, 98%, 98%, a,ß-Dibromohydrocinnamic acid, 98%. Offered by: GLPBio, TCI, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
2,3-dibromo-3-phenylpropanoic acid (CAS 6286-30-2) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 2,3-dibromo-3-phenylpropanoic acid. InChIKey: FXJWTHBNVZNQQP-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | 2,3-dibromo-3-phenylpropanoic acid |
| InChIKey | FXJWTHBNVZNQQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(C(=O)O)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
2,3-Dibromo-3-phenylpropionic acid, 2,3-Dibromo-3-phenylpropanoic acid, alpha,beta-Dibromohydrocinnamic acid, 2,3-Dibromohydrocinnamic acid, a,ss-Dibromohydrocinnamic acid, Propionic acid, 2,3-dibromo-3-phenyl-, .alpha.,.beta.-Dibromohydrocinnamic acid, Hydrocinnamic acid, .alpha.,.beta.-dibromo-, Benzenepropanoic acid, .alpha.,.beta.-dibromo-, alpha , beta -Dibromohydrocinnamic acid