CAS 1809168-60-2 appears in our catalog under these names: 2',5'-Dibromo-4'-methoxyacetophenone, 97%, 2',5'-Dibromo-4'-methoxyacetophenone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 10g, 5g, 1g.
1-(2,5-dibromo-4-methoxyphenyl)ethanone (CAS 1809168-60-2) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 1-(2,5-dibromo-4-methoxyphenyl)ethanone. InChIKey: BUGKPLRPZGJAPK-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | 1-(2,5-dibromo-4-methoxyphenyl)ethanone |
| InChIKey | BUGKPLRPZGJAPK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1Br)OC)Br |
Computed by PubChem (NCBI)