Products 63810-80-0
CAS 63810-80-0 appears in our catalog under these names: 2,3-Dichloro-6,7-dimethylquinoxaline, 97%, 97%, 2,3-Dichloro-6,7-dimethylquinoxaline, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 2.5g.
2,3-dichloro-6,7-dimethylquinoxaline (CAS 63810-80-0) is a chemical compound with the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. IUPAC name: 2,3-dichloro-6,7-dimethylquinoxaline. InChIKey: NKBSIBTVPNHSIK-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 2,3-dichloro-6,7-dimethylquinoxaline |
| InChIKey | NKBSIBTVPNHSIK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)