CAS 102993-73-7 appears in our catalog under these names: Isoconazole Impurity 8, 1-(2,6-Dichlorobenzyl)-1H-imidazole 98%, 1-(2,6-dichlorobenzyl)-1H-imidazole, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
1-[(2,6-dichlorophenyl)methyl]imidazole (CAS 102993-73-7) is a chemical compound with the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. IUPAC name: 1-[(2,6-dichlorophenyl)methyl]imidazole. InChIKey: BJJYAUDWBQBWPJ-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 1-[(2,6-dichlorophenyl)methyl]imidazole |
| InChIKey | BJJYAUDWBQBWPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CN2C=CN=C2)Cl |
Computed by PubChem (NCBI)