Products 1053657-20-7
CAS 1053657-20-7 is the registry number for 5-Chloromethyl-2-(4-chlorophenyl)-1h-imidazole, 96%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-(chloromethyl)-2-(4-chlorophenyl)-1H-imidazole (CAS 1053657-20-7) is a chemical compound with the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. IUPAC name: 5-(chloromethyl)-2-(4-chlorophenyl)-1H-imidazole. InChIKey: ZTZALKNSSDQIHI-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 5-(chloromethyl)-2-(4-chlorophenyl)-1H-imidazole |
| InChIKey | ZTZALKNSSDQIHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(N2)CCl)Cl |
Computed by PubChem (NCBI)