Products 524740-38-3
CAS 524740-38-3 is the registry number for 5-Chloro-3-(4-chlorophenyl)-1-methyl-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-(4-chlorophenyl)-1-methylpyrazole (CAS 524740-38-3) is a chemical compound with the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. IUPAC name: 5-chloro-3-(4-chlorophenyl)-1-methylpyrazole. InChIKey: UVWPPQDUMZLXSK-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 5-chloro-3-(4-chlorophenyl)-1-methylpyrazole |
| InChIKey | UVWPPQDUMZLXSK-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)