Products 917562-03-9
CAS 917562-03-9 appears in our catalog under these names: 4-Amino-5,7-dichloro-2-methylquinoline, 95%, 5,7-Dichloro-2-methylquinolin-4-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5,7-dichloro-2-methylquinolin-4-amine (CAS 917562-03-9) is a chemical compound with the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. IUPAC name: 5,7-dichloro-2-methylquinolin-4-amine. InChIKey: WGXAEZMNZHRTNP-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 5,7-dichloro-2-methylquinolin-4-amine |
| InChIKey | WGXAEZMNZHRTNP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=CC(=CC2=N1)Cl)Cl)N |
Computed by PubChem (NCBI)