2,3-Dichloro-6-(methoxymethoxy)benzoic acid, 98%
cas: 2179038-27-6 — see every product listed under this CAS number, including other names
2,3-Dichloro-6-(methoxymethoxy)benzoic acid, 98% (CAS 2179038-27-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1639887-5g |
| cas | 2179038-27-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15557.29 Pln | |
| AmBeed | 10g | 26474.56 Pln | |
| AmBeed | 25g | 51948.19 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,3-dichloro-6-(methoxymethoxy)benzoic acid (CAS 2179038-27-6) is a chemical compound with the molecular formula C9H8Cl2O4 and a molecular weight of 251.06 g/mol. IUPAC name: 2,3-dichloro-6-(methoxymethoxy)benzoic acid. InChIKey: MOAOLHXEIDDAJS-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O4 |
|---|---|
| Molecular weight | 251.06 g/mol |
| IUPAC name | 2,3-dichloro-6-(methoxymethoxy)benzoic acid |
| InChIKey | MOAOLHXEIDDAJS-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C(=C(C=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)