CAS 1327292-78-3 is the registry number for Methyl 2,5-dichloro-3-hydroxy-6-methoxybenzoate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 2,5-dichloro-3-hydroxy-6-methoxybenzoate (CAS 1327292-78-3) is a chemical compound with the molecular formula C9H8Cl2O4 and a molecular weight of 251.06 g/mol. IUPAC name: methyl 2,5-dichloro-3-hydroxy-6-methoxybenzoate. InChIKey: PRFFJHPDSUWPLE-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O4 |
|---|---|
| Molecular weight | 251.06 g/mol |
| IUPAC name | methyl 2,5-dichloro-3-hydroxy-6-methoxybenzoate |
| InChIKey | PRFFJHPDSUWPLE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1C(=O)OC)Cl)O)Cl |
Computed by PubChem (NCBI)