CAS 136577-14-5 is the registry number for 3,5-Dichloro-6-ethyl-2,4-dihydroxybenzoic Acid. Offered by: TRC. Available pack sizes: 50mg.
3,5-dichloro-2-ethyl-4,6-dihydroxybenzoic acid (CAS 136577-14-5) is a chemical compound with the molecular formula C9H8Cl2O4 and a molecular weight of 251.06 g/mol. IUPAC name: 3,5-dichloro-2-ethyl-4,6-dihydroxybenzoic acid. InChIKey: UKNMCZFIVWCUHZ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O4 |
|---|---|
| Molecular weight | 251.06 g/mol |
| IUPAC name | 3,5-dichloro-2-ethyl-4,6-dihydroxybenzoic acid |
| InChIKey | UKNMCZFIVWCUHZ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C(=C1Cl)O)Cl)O)C(=O)O |
Computed by PubChem (NCBI)