Products 248953-28-8

CAS 248953-28-8 is the registry number for 3-(3,5-Dichloro-4-hydroxyphenyl)-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3,5-dichloro-4-hydroxyphenyl)-2-hydroxypropanoic acid (CAS 248953-28-8) is a chemical compound with the molecular formula C9H8Cl2O4 and a molecular weight of 251.06 g/mol. IUPAC name: 3-(3,5-dichloro-4-hydroxyphenyl)-2-hydroxypropanoic acid. InChIKey: SZTRQLJGWGDPGE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2O4
Molecular weight251.06 g/mol
IUPAC name3-(3,5-dichloro-4-hydroxyphenyl)-2-hydroxypropanoic acid
InChIKeySZTRQLJGWGDPGE-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)O)Cl)CC(C(=O)O)O

Computed by PubChem (NCBI)