CAS 75177-59-2 appears in our catalog under these names: 2,6-dichloro-3,5-dimethoxybenzoic acid, 95%, 95%, 2,6-DICHLORO-3,5-DIMETHOXYBENZOIC ACID, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2,6-dichloro-3,5-dimethoxybenzoic acid (CAS 75177-59-2) is a chemical compound with the molecular formula C9H8Cl2O4 and a molecular weight of 251.06 g/mol. IUPAC name: 2,6-dichloro-3,5-dimethoxybenzoic acid. InChIKey: SOTISHMVHPPTBO-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O4 |
|---|---|
| Molecular weight | 251.06 g/mol |
| IUPAC name | 2,6-dichloro-3,5-dimethoxybenzoic acid |
| InChIKey | SOTISHMVHPPTBO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)C(=O)O)Cl)OC |
Computed by PubChem (NCBI)