cas: 10236-60-9 — see every product listed under this CAS number, including other names
2,3-Dichlorophenylacetic Acid, >98.0%(GC)(T) (CAS 10236-60-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2931-5G |
| cas | 10236-60-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 290.45 Pln | |
| TCI | 25g | 1313.24 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-(2,3-dichlorophenyl)acetic acid (CAS 10236-60-9) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)acetic acid. InChIKey: YWMXEUIQZOQESD-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)acetic acid |
| InChIKey | YWMXEUIQZOQESD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)