cas: 10236-60-9 — see every product listed under this CAS number, including other names
2-(2,3-dichlorophenyl)acetic acid, ≥98%, ≥98% (CAS 10236-60-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111808-1g |
| cas | 10236-60-9 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 100g | 573.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
2-(2,3-dichlorophenyl)acetic acid (CAS 10236-60-9) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)acetic acid. InChIKey: YWMXEUIQZOQESD-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)acetic acid |
| InChIKey | YWMXEUIQZOQESD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)