cas: 2586126-70-5 — see every product listed under this CAS number, including other names
2,3-Difluoro-4-(methoxymethoxy)benzaldehyde, 98% (CAS 2586126-70-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1655878-10g |
| cas | 2586126-70-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 25882.15 Pln | |
| AmBeed | 5g | 15218.77 Pln | |
| AmBeed | 25g | 50763.37 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,3-difluoro-4-(methoxymethoxy)benzaldehyde (CAS 2586126-70-5) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2,3-difluoro-4-(methoxymethoxy)benzaldehyde. InChIKey: UNGFTVUDLRYKDT-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2,3-difluoro-4-(methoxymethoxy)benzaldehyde |
| InChIKey | UNGFTVUDLRYKDT-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C(=C(C=C1)C=O)F)F |
Computed by PubChem (NCBI)