Products 1935223-46-3

CAS 1935223-46-3 is the registry number for 4-Ethoxy-2,5-difluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-ethoxy-2,5-difluorobenzoic acid (CAS 1935223-46-3) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 4-ethoxy-2,5-difluorobenzoic acid. InChIKey: BZNRQAQBSVMJOB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O3
Molecular weight202.15 g/mol
IUPAC name4-ethoxy-2,5-difluorobenzoic acid
InChIKeyBZNRQAQBSVMJOB-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C(=C1)F)C(=O)O)F

Computed by PubChem (NCBI)