cas: 1637386-43-6 — see every product listed under this CAS number, including other names
2,3-Difluoro-4-(phenylmethoxy)benzyl alcohol (CAS 1637386-43-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631598-1G |
| cas | 1637386-43-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2762.59 Pln | |
| Fluorochem | 5g | 8166.93 Pln |
| delivery time | 3-4 weeks |
|---|
(2,3-difluoro-4-phenylmethoxyphenyl)methanol (CAS 1637386-43-6) is a chemical compound with the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. IUPAC name: (2,3-difluoro-4-phenylmethoxyphenyl)methanol. InChIKey: NNKIMNSEQZEAJD-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O2 |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | (2,3-difluoro-4-phenylmethoxyphenyl)methanol |
| InChIKey | NNKIMNSEQZEAJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)CO)F)F |
Computed by PubChem (NCBI)