Products 73790-02-0

CAS 73790-02-0 is the registry number for Ethyl difluoro(naphthalen-2-yl)acetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.

Structural formula: {0} (CAS {1})

Ethyl 2,2-difluoro-2-naphthalen-2-ylacetate (CAS 73790-02-0) is a chemical compound with the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. IUPAC name: ethyl 2,2-difluoro-2-naphthalen-2-ylacetate. InChIKey: LEYZSOGWZPUAAP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12F2O2
Molecular weight250.24 g/mol
IUPAC nameethyl 2,2-difluoro-2-naphthalen-2-ylacetate
InChIKeyLEYZSOGWZPUAAP-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=CC2=CC=CC=C2C=C1)(F)F

Computed by PubChem (NCBI)