Products 1826110-02-4
CAS 1826110-02-4 appears in our catalog under these names: 3-Benzyloxy-2,6-difluorobenzyl alcohol, 95%, 3-Benzyloxy-2,6-difluorobenzylalcohol, ≥95%, ≥95%, 3-Benzyloxy-2,6-difluorobenzyl alcohol. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(2,6-difluoro-3-phenylmethoxyphenyl)methanol (CAS 1826110-02-4) is a chemical compound with the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. IUPAC name: (2,6-difluoro-3-phenylmethoxyphenyl)methanol. InChIKey: FSQJCQOKVDNXJB-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O2 |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | (2,6-difluoro-3-phenylmethoxyphenyl)methanol |
| InChIKey | FSQJCQOKVDNXJB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)CO)F |
Computed by PubChem (NCBI)