CAS 1936712-89-8 appears in our catalog under these names: (2,5-Difluoro-4-phenylmethoxyphenyl)methanol, 95%, (2,5-Difluoro-4-phenylmethoxyphenyl)methanol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
(2,5-difluoro-4-phenylmethoxyphenyl)methanol (CAS 1936712-89-8) is a chemical compound with the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. IUPAC name: (2,5-difluoro-4-phenylmethoxyphenyl)methanol. InChIKey: ILZBTKRODUCAGJ-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O2 |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | (2,5-difluoro-4-phenylmethoxyphenyl)methanol |
| InChIKey | ILZBTKRODUCAGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C(=C2)F)CO)F |
Computed by PubChem (NCBI)