Products 1637386-43-6

CAS 1637386-43-6 is the registry number for 2,3-Difluoro-4-(phenylmethoxy)benzyl alcohol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2,3-difluoro-4-phenylmethoxyphenyl)methanol (CAS 1637386-43-6) is a chemical compound with the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. IUPAC name: (2,3-difluoro-4-phenylmethoxyphenyl)methanol. InChIKey: NNKIMNSEQZEAJD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12F2O2
Molecular weight250.24 g/mol
IUPAC name(2,3-difluoro-4-phenylmethoxyphenyl)methanol
InChIKeyNNKIMNSEQZEAJD-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C(=C(C=C2)CO)F)F

Computed by PubChem (NCBI)