cas: 2096332-61-3 — see every product listed under this CAS number, including other names
2,3-Difluoro-4-(trifluoromethyl)benzeneboronic acid, 96%, 96% (CAS 2096332-61-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHAX-100mg |
| cas | 2096332-61-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 563.60 Pln | |
| Chemat | 5g | 1758.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[2,3-difluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS 2096332-61-3) is a chemical compound with the molecular formula C7H4BF5O2 and a molecular weight of 225.91 g/mol. IUPAC name: [2,3-difluoro-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: KFZQEXGUUYWITP-UHFFFAOYSA-N.
| Molecular formula | C7H4BF5O2 |
|---|---|
| Molecular weight | 225.91 g/mol |
| IUPAC name | [2,3-difluoro-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | KFZQEXGUUYWITP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C(F)(F)F)F)F)(O)O |
Computed by PubChem (NCBI)