cas: 1075701-01-7 — see every product listed under this CAS number, including other names
2,3-Difluoro-6-(methoxymethoxy)benzaldehyde, 98%, 98% (CAS 1075701-01-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132QER-100mg |
| cas | 1075701-01-7 |
| size | 100mg |
| availability | 11g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 957.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3-difluoro-6-(methoxymethoxy)benzaldehyde (CAS 1075701-01-7) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2,3-difluoro-6-(methoxymethoxy)benzaldehyde. InChIKey: AOJHMDKAPQDKLB-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2,3-difluoro-6-(methoxymethoxy)benzaldehyde |
| InChIKey | AOJHMDKAPQDKLB-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C(=C(C=C1)F)F)C=O |
Computed by PubChem (NCBI)