2,3-Difluoronitrobenzene, 98%
cas: 6921-22-8 — see every product listed under this CAS number, including other names
2,3-Difluoronitrobenzene, 98% (CAS 6921-22-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F044873-1G |
| cas | 6921-22-8 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 10g | 388.42 Pln | |
| Fluorochem | 25g | 857.01 Pln | |
| Fluorochem | 100g | 3231.17 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 10g | 387.06 Pln | |
| Ambeed | 25g | 859.88 Pln | |
| Ambeed | 100g | 3218.38 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 299.60 Pln | |
| Chemat | 25g | 664.40 Pln | |
| Chemat | 100g | 2426.00 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
1,2-difluoro-3-nitrobenzene (CAS 6921-22-8) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 1,2-difluoro-3-nitrobenzene. InChIKey: IXIJRPBFPLESEI-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 1,2-difluoro-3-nitrobenzene |
| InChIKey | IXIJRPBFPLESEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)