Products 364-74-9
CAS 364-74-9 appears in our catalog under these names: 2,5–Difluoronitrobenzene, 2,5-Difluoronitrobenzene, >98.0%(GC), 2,5-Difluoronitrobenzene 98%, 2,5-Difluoronitrobenzene, 97%, 2,5-Difluoronitrobenzene, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 5g, 10g, 500g, 1000g, 1kg, 5kg.
1,4-difluoro-2-nitrobenzene (CAS 364-74-9) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 1,4-difluoro-2-nitrobenzene. InChIKey: XNJAYQHWXYJBBD-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 1,4-difluoro-2-nitrobenzene |
| InChIKey | XNJAYQHWXYJBBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)