cas: 19499-93-5 — see every product listed under this CAS number, including other names
2,3-Dimethyl-4-nitrophenol, 95% (CAS 19499-93-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 20g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209448-1G |
| cas | 19499-93-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 200.99 Pln | |
| Fluorochem | 20g | 294.71 Pln | |
| Fluorochem | 25g | 346.77 Pln | |
| Fluorochem | 100g | 1216.26 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2,3-dimethyl-4-nitrophenol (CAS 19499-93-5) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,3-dimethyl-4-nitrophenol. InChIKey: DAEZHJNJHQAEPE-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,3-dimethyl-4-nitrophenol |
| InChIKey | DAEZHJNJHQAEPE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)