CAS 19499-93-5 appears in our catalog under these names: 2,3-Dimethyl-4-nitrophenol, 98%, 2,3–Dimethyl–4–nitrophenol, 2,3-Dimethyl-4-nitrophenol, >98.0%(GC), 2,3-Dimethyl-4-nitrophenol 97%, 2,3-Dimethyl-4-nitrophenol, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg, 20g.
2,3-dimethyl-4-nitrophenol (CAS 19499-93-5) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,3-dimethyl-4-nitrophenol. InChIKey: DAEZHJNJHQAEPE-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,3-dimethyl-4-nitrophenol |
| InChIKey | DAEZHJNJHQAEPE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)