cas: 19499-93-5 — see every product listed under this CAS number, including other names
2,3-Dimethyl-4-nitrophenol, 97%, 97% (CAS 19499-93-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FK4-250mg |
| cas | 19499-93-5 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 299.60 Pln | |
| Chemat | 100g | 966.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3-dimethyl-4-nitrophenol (CAS 19499-93-5) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,3-dimethyl-4-nitrophenol. InChIKey: DAEZHJNJHQAEPE-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,3-dimethyl-4-nitrophenol |
| InChIKey | DAEZHJNJHQAEPE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)