cas: 2055841-29-5 — see every product listed under this CAS number, including other names
2,3-dibromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine, 97% (CAS 2055841-29-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F519143-100MG |
| cas | 2055841-29-5 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 695.61 Pln | |
| Fluorochem | 250mg | 1106.92 Pln | |
| Fluorochem | 500mg | 1544.27 Pln | |
| Fluorochem | 1g | 2241.94 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 664.40 Pln | |
| Chemat | 500mg | 918.80 Pln | |
| Chemat | 1g | 1341.20 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2,3-dibromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine (CAS 2055841-29-5) is a chemical compound with the molecular formula C8H6Br2N2O and a molecular weight of 305.95 g/mol. IUPAC name: 2,3-dibromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine. InChIKey: SSJXDKJSRSEXJT-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2O |
|---|---|
| Molecular weight | 305.95 g/mol |
| IUPAC name | 2,3-dibromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | SSJXDKJSRSEXJT-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)C(=C(N2)Br)Br |
Computed by PubChem (NCBI)